C16H19NO4 — CID 114343667
2-[1-(2,3-dihydroxybenzoyl)pyrrolidin-2-yl]cyclopentan-1-one (PubChem CID 114343667) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[1-(2,3-dihydroxybenzoyl)pyrrolidin-2-yl]cyclopentan-1-one.
| Compound Name | 2-[1-(2,3-dihydroxybenzoyl)pyrrolidin-2-yl]cyclopentan-1-one |
|---|---|
| PubChem CID | 114343667 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-[1-(2,3-dihydroxybenzoyl)pyrrolidin-2-yl]cyclopentan-1-one |
| SMILES | O=C1CCCC1C1CCCN1C(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C16H19NO4/c18-13-7-1-4-10(13)12-6-3-9-17(12)16(21)11-5-2-8-14(19)15(11)20/h2,5,8,10,12,19-20H,1,3-4,6-7,9H2 |
| InChIKey | TWFJDQRLQAKIED-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|