C20H22N2O3 — CID 96535372
4-[(2S)-2-[(1R)-2-oxocyclohexyl]pyrrolidine-1-carbonyl]-1H-quinolin-2-one (PubChem CID 96535372) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-[(2S)-2-[(1R)-2-oxocyclohexyl]pyrrolidine-1-carbonyl]-1H-quinolin-2-one.
| Compound Name | 4-[(2S)-2-[(1R)-2-oxocyclohexyl]pyrrolidine-1-carbonyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 96535372 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 4-[(2S)-2-[(1R)-2-oxocyclohexyl]pyrrolidine-1-carbonyl]-1H-quinolin-2-one |
| SMILES | O=C1CCCC[C@@H]1[C@@H]1CCCN1C(=O)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C20H22N2O3/c23-18-10-4-2-7-14(18)17-9-5-11-22(17)20(25)15-12-19(24)21-16-8-3-1-6-13(15)16/h1,3,6,8,12,14,17H,2,4-5,7,9-11H2,(H,21,24)/t14-,17+/m1/s1 |
| InChIKey | KWRUFSFYJHFECI-PBHICJAKSA-N |
| XLogP | 2.89 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |