C16H20N2O3 — CID 106741554
3-[2-(2-oxocyclohexyl)pyrrolidine-1-carbonyl]-1H-pyridin-4-one (PubChem CID 106741554) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-[2-(2-oxocyclohexyl)pyrrolidine-1-carbonyl]-1H-pyridin-4-one.
| Compound Name | 3-[2-(2-oxocyclohexyl)pyrrolidine-1-carbonyl]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 106741554 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 3-[2-(2-oxocyclohexyl)pyrrolidine-1-carbonyl]-1H-pyridin-4-one |
| SMILES | O=C1CCCCC1C1CCCN1C(=O)c1c[nH]ccc1=O |
| InChI | InChI=1S/C16H20N2O3/c19-14-6-2-1-4-11(14)13-5-3-9-18(13)16(21)12-10-17-8-7-15(12)20/h7-8,10-11,13H,1-6,9H2,(H,17,20) |
| InChIKey | YSEFAMPQBUTXEN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |