C12H18N6O3 — CID 103470430
6-(3,4-dimethylpiperazin-1-yl)-N'-hydroxy-5-nitropyridine-3-carboximidamide (PubChem CID 103470430) has the molecular formula C12H18N6O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 6-(3,4-dimethylpiperazin-1-yl)-N'-hydroxy-5-nitropyridine-3-carboximidamide.
| Compound Name | 6-(3,4-dimethylpiperazin-1-yl)-N'-hydroxy-5-nitropyridine-3-carboximidamide |
|---|---|
| PubChem CID | 103470430 |
| Molecular Formula | C12H18N6O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 6-(3,4-dimethylpiperazin-1-yl)-N'-hydroxy-5-nitropyridine-3-carboximidamide |
| SMILES | CC1CN(c2ncc(C(N)=NO)cc2[N+](=O)[O-])CCN1C |
| InChI | InChI=1S/C12H18N6O3/c1-8-7-17(4-3-16(8)2)12-10(18(20)21)5-9(6-14-12)11(13)15-19/h5-6,8,19H,3-4,7H2,1-2H3,(H2,13,15) |
| InChIKey | JVRJLWAUQNCNMF-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|