C16H12ClFK2N3O6PS — CID 10347160
dipotassium;4-[4-chloro-5-(3-fluoro-4-methoxyphenyl)imidazol-1-yl]-N-phosphonatobenzenesulfonamide (PubChem CID 10347160) has the molecular formula C16H12ClFK2N3O6PS and a molecular weight of 537.98 g/mol. Its IUPAC name is dipotassium;4-[4-chloro-5-(3-fluoro-4-methoxyphenyl)imidazol-1-yl]-N-phosphonatobenzenesulfonamide.
| Compound Name | dipotassium;4-[4-chloro-5-(3-fluoro-4-methoxyphenyl)imidazol-1-yl]-N-phosphonatobenzenesulfonamide |
|---|---|
| PubChem CID | 10347160 |
| Molecular Formula | C16H12ClFK2N3O6PS |
| Molecular Weight | 537.98 g/mol |
| Exact Mass | 536.91 |
| IUPAC Name | dipotassium;4-[4-chloro-5-(3-fluoro-4-methoxyphenyl)imidazol-1-yl]-N-phosphonatobenzenesulfonamide |
| SMILES | COc1ccc(-c2c(Cl)ncn2-c2ccc(S(=O)(=O)NP(=O)([O-])[O-])cc2)cc1F.[K+].[K+] |
| InChI | InChI=1S/C16H14ClFN3O6PS.2K/c1-27-14-7-2-10(8-13(14)18)15-16(17)19-9-21(15)11-3-5-12(6-4-11)29(25,26)20-28(22,23)24;;/h2-9H,1H3,(H3,20,22,23,24);;/q;2*+1/p-2 |
| InChIKey | HXENQQGYTSHCPA-UHFFFAOYSA-L |
| XLogP | -4.54 |
| TPSA | 136.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.98 |
| LogP ≤ 5 | -4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|