C8H9ClF4N2O2 — CID 103472301
5-(1-chloroethyl)-3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazole (PubChem CID 103472301) has the molecular formula C8H9ClF4N2O2 and a molecular weight of 276.62 g/mol. Its IUPAC name is 5-(1-chloroethyl)-3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazole.
| Compound Name | 5-(1-chloroethyl)-3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103472301 |
| Molecular Formula | C8H9ClF4N2O2 |
| Molecular Weight | 276.62 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 5-(1-chloroethyl)-3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazole |
| SMILES | CC(Cl)c1nc(COCC(F)(F)C(F)F)no1 |
| InChI | InChI=1S/C8H9ClF4N2O2/c1-4(9)6-14-5(15-17-6)2-16-3-8(12,13)7(10)11/h4,7H,2-3H2,1H3 |
| InChIKey | VGSODCQSTFBXSR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.62 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|