C9H11ClF4N2O2 — CID 103472308
5-(3-chloropropyl)-3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazole (PubChem CID 103472308) has the molecular formula C9H11ClF4N2O2 and a molecular weight of 290.64 g/mol. Its IUPAC name is 5-(3-chloropropyl)-3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazole.
| Compound Name | 5-(3-chloropropyl)-3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103472308 |
| Molecular Formula | C9H11ClF4N2O2 |
| Molecular Weight | 290.64 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 5-(3-chloropropyl)-3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazole |
| SMILES | FC(F)C(F)(F)COCc1noc(CCCCl)n1 |
| InChI | InChI=1S/C9H11ClF4N2O2/c10-3-1-2-7-15-6(16-18-7)4-17-5-9(13,14)8(11)12/h8H,1-5H2 |
| InChIKey | ZLNHPFGWSZLGCN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.64 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|