C7H9F4N3O3 — CID 103473108
O-[[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]methyl]hydroxylamine (PubChem CID 103473108) has the molecular formula C7H9F4N3O3 and a molecular weight of 259.16 g/mol. Its IUPAC name is O-[[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]methyl]hydroxylamine.
| Compound Name | O-[[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 103473108 |
| Molecular Formula | C7H9F4N3O3 |
| Molecular Weight | 259.16 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | O-[[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]methyl]hydroxylamine |
| SMILES | NOCc1nc(COCC(F)(F)C(F)F)no1 |
| InChI | InChI=1S/C7H9F4N3O3/c8-6(9)7(10,11)3-15-1-4-13-5(2-16-12)17-14-4/h6H,1-3,12H2 |
| InChIKey | PTNCVCMRCQGYCE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.16 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|