About 5-(fluoromethyl)-3-(methoxymethyl)-1,2,4-oxadiazole
5-(fluoromethyl)-3-(methoxymethyl)-1,2,4-oxadiazole (PubChem CID 139835743) has the molecular formula C5H7FN2O2
and a molecular weight of 146.12 g/mol. Its IUPAC name is 5-(fluoromethyl)-3-(methoxymethyl)-1,2,4-oxadiazole.
Analyze 5-(fluoromethyl)-3-(methoxymethyl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(fluoromethyl)-3-(methoxymethyl)-1,2,4-oxadiazole?
The IUPAC name of 5-(fluoromethyl)-3-(methoxymethyl)-1,2,4-oxadiazole (CID 139835743) is 5-(fluoromethyl)-3-(methoxymethyl)-1,2,4-oxadiazole.
What is the SMILES notation for 5-(fluoromethyl)-3-(methoxymethyl)-1,2,4-oxadiazole?
The canonical SMILES for 5-(fluoromethyl)-3-(methoxymethyl)-1,2,4-oxadiazole is COCc1noc(CF)n1.
What is the InChIKey of 5-(fluoromethyl)-3-(methoxymethyl)-1,2,4-oxadiazole?
The InChIKey is LIZFCBKGMRGUMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7FN2O2/c1-9-3-4-7-5(2-6)10-8-4/h2-3H2,1H3.
What are the key properties of 5-(fluoromethyl)-3-(methoxymethyl)-1,2,4-oxadiazole?
5-(fluoromethyl)-3-(methoxymethyl)-1,2,4-oxadiazole has a molecular weight of 146.12 g/mol, XLogP of 0.69, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(fluoromethyl)-3-(methoxymethyl)-1,2,4-oxadiazole is sourced from PubChem (CID 139835743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).