About ethyl 5-(difluoromethyl)-1,2,4-oxadiazole-3-carboxylate
ethyl 5-(difluoromethyl)-1,2,4-oxadiazole-3-carboxylate (PubChem CID 104632904) has the molecular formula C6H6F2N2O3
and a molecular weight of 192.12 g/mol. Its IUPAC name is ethyl 5-(difluoromethyl)-1,2,4-oxadiazole-3-carboxylate.
Analyze ethyl 5-(difluoromethyl)-1,2,4-oxadiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(difluoromethyl)-1,2,4-oxadiazole-3-carboxylate?
The IUPAC name of ethyl 5-(difluoromethyl)-1,2,4-oxadiazole-3-carboxylate (CID 104632904) is ethyl 5-(difluoromethyl)-1,2,4-oxadiazole-3-carboxylate.
What is the SMILES notation for ethyl 5-(difluoromethyl)-1,2,4-oxadiazole-3-carboxylate?
The canonical SMILES for ethyl 5-(difluoromethyl)-1,2,4-oxadiazole-3-carboxylate is CCOC(=O)c1noc(C(F)F)n1.
What is the InChIKey of ethyl 5-(difluoromethyl)-1,2,4-oxadiazole-3-carboxylate?
The InChIKey is LVWPMIHPQNMKLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F2N2O3/c1-2-12-6(11)4-9-5(3(7)8)13-10-4/h3H,2H2,1H3.
What are the key properties of ethyl 5-(difluoromethyl)-1,2,4-oxadiazole-3-carboxylate?
ethyl 5-(difluoromethyl)-1,2,4-oxadiazole-3-carboxylate has a molecular weight of 192.12 g/mol, XLogP of 1.18, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(difluoromethyl)-1,2,4-oxadiazole-3-carboxylate is sourced from PubChem (CID 104632904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).