C8H8F4N2O3 — CID 103473467
4-hydroxy-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one (PubChem CID 103473467) has the molecular formula C8H8F4N2O3 and a molecular weight of 256.15 g/mol. Its IUPAC name is 4-hydroxy-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103473467 |
| Molecular Formula | C8H8F4N2O3 |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 4-hydroxy-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(O)nc(COCC(F)(F)C(F)F)[nH]1 |
| InChI | InChI=1S/C8H8F4N2O3/c9-7(10)8(11,12)3-17-2-4-13-5(15)1-6(16)14-4/h1,7H,2-3H2,(H2,13,14,15,16) |
| InChIKey | HWQOMHGXDBWMNX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|