C8H8F4N2O2 — CID 103473450
2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one (PubChem CID 103473450) has the molecular formula C8H8F4N2O2 and a molecular weight of 240.16 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103473450 |
| Molecular Formula | C8H8F4N2O2 |
| Molecular Weight | 240.16 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(COCC(F)(F)C(F)F)[nH]1 |
| InChI | InChI=1S/C8H8F4N2O2/c9-7(10)8(11,12)4-16-3-5-13-2-1-6(15)14-5/h1-2,7H,3-4H2,(H,13,14,15) |
| InChIKey | SPTHLBKOTKLGRN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.16 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|