C8H7F4IN2O2 — CID 103473504
5-iodo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one (PubChem CID 103473504) has the molecular formula C8H7F4IN2O2 and a molecular weight of 366.05 g/mol. Its IUPAC name is 5-iodo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103473504 |
| Molecular Formula | C8H7F4IN2O2 |
| Molecular Weight | 366.05 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 5-iodo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(COCC(F)(F)C(F)F)ncc1I |
| InChI | InChI=1S/C8H7F4IN2O2/c9-7(10)8(11,12)3-17-2-5-14-1-4(13)6(16)15-5/h1,7H,2-3H2,(H,14,15,16) |
| InChIKey | ZKHFMTIDYFOLAD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.05 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|