C7H6F3IN2O2 — CID 103473505
5-iodo-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one (PubChem CID 103473505) has the molecular formula C7H6F3IN2O2 and a molecular weight of 334.04 g/mol. Its IUPAC name is 5-iodo-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103473505 |
| Molecular Formula | C7H6F3IN2O2 |
| Molecular Weight | 334.04 g/mol |
| Exact Mass | 333.94 |
| IUPAC Name | 5-iodo-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(COCC(F)(F)F)ncc1I |
| InChI | InChI=1S/C7H6F3IN2O2/c8-7(9,10)3-15-2-5-12-1-4(11)6(14)13-5/h1H,2-3H2,(H,12,13,14) |
| InChIKey | PNEZSOOEAMLLOE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.04 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|