C7H7F3N2O2 — CID 166796824
2-methyl-5-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one (PubChem CID 166796824) has the molecular formula C7H7F3N2O2 and a molecular weight of 208.14 g/mol. Its IUPAC name is 2-methyl-5-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-5-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 166796824 |
| Molecular Formula | C7H7F3N2O2 |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-methyl-5-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one |
| SMILES | Cc1ncc(OCC(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C7H7F3N2O2/c1-4-11-2-5(6(13)12-4)14-3-7(8,9)10/h2H,3H2,1H3,(H,11,12,13) |
| InChIKey | HGZBRANNCLVIOU-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |