C9H11F4N3O2 — CID 136890491
4-(aminomethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136890491) has the molecular formula C9H11F4N3O2 and a molecular weight of 269.20 g/mol. Its IUPAC name is 4-(aminomethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-(aminomethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136890491 |
| Molecular Formula | C9H11F4N3O2 |
| Molecular Weight | 269.20 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-(aminomethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
| SMILES | NCc1cc(=O)[nH]c(COCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C9H11F4N3O2/c10-8(11)9(12,13)4-18-3-6-15-5(2-14)1-7(17)16-6/h1,8H,2-4,14H2,(H,15,16,17) |
| InChIKey | ZOAVYEIJPACQJP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|