C11H13F4N3O3 — CID 136662120
N-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide (PubChem CID 136662120) has the molecular formula C11H13F4N3O3 and a molecular weight of 311.24 g/mol. Its IUPAC name is N-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide.
| Compound Name | N-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
|---|---|
| PubChem CID | 136662120 |
| Molecular Formula | C11H13F4N3O3 |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
| SMILES | Cc1nc(CNC(=O)COCC(F)(F)C(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C11H13F4N3O3/c1-6-17-7(2-8(19)18-6)3-16-9(20)4-21-5-11(14,15)10(12)13/h2,10H,3-5H2,1H3,(H,16,20)(H,17,18,19) |
| InChIKey | LAOLFCPABPVQLA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|