About 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one
2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 103146593) has the molecular formula C8H9F3N2O2
and a molecular weight of 222.17 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| PubChem CID | 103146593 |
| Molecular Formula | C8H9F3N2O2 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(CCOCC(F)(F)F)[nH]1 |
| InChI | InChI=1S/C8H9F3N2O2/c9-8(10,11)5-15-4-2-6-12-3-1-7(14)13-6/h1,3H,2,4-5H2,(H,12,13,14) |
| InChIKey | LDPXGPDCSSHGAI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one?
The IUPAC name of 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one (CID 103146593) is 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one.
What is the SMILES notation for 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one?
The canonical SMILES for 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one is O=c1ccnc(CCOCC(F)(F)F)[nH]1.
What is the InChIKey of 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one?
The InChIKey is LDPXGPDCSSHGAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O2/c9-8(10,11)5-15-4-2-6-12-3-1-7(14)13-6/h1,3H,2,4-5H2,(H,12,13,14).
What are the key properties of 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one?
2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one has a molecular weight of 222.17 g/mol, XLogP of 0.89, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one is sourced from PubChem (CID 103146593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).