C8H9F3N2O2 — CID 103146593
2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 103146593) has the molecular formula C8H9F3N2O2 and a molecular weight of 222.17 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103146593 |
| Molecular Formula | C8H9F3N2O2 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(CCOCC(F)(F)F)[nH]1 |
| InChI | InChI=1S/C8H9F3N2O2/c9-8(10,11)5-15-4-2-6-12-3-1-7(14)13-6/h1,3H,2,4-5H2,(H,12,13,14) |
| InChIKey | LDPXGPDCSSHGAI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|