C7H10KN2O — CID 172758023
CID 172758023 (PubChem CID 172758023) has the molecular formula C7H10KN2O and a molecular weight of 177.27 g/mol.
| Compound Name | CID 172758023 |
|---|---|
| PubChem CID | 172758023 |
| Molecular Formula | C7H10KN2O |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | — |
| SMILES | CCCc1nccc(=O)[nH]1.[K] |
| InChI | InChI=1S/C7H10N2O.K/c1-2-3-6-8-5-4-7(10)9-6;/h4-5H,2-3H2,1H3,(H,8,9,10); |
| InChIKey | LHIDQZJQHJRAFE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |