C10H12F4O3 — CID 103473685
1-(3,4-dihydro-2H-pyran-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanone (PubChem CID 103473685) has the molecular formula C10H12F4O3 and a molecular weight of 256.19 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanone.
| Compound Name | 1-(3,4-dihydro-2H-pyran-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanone |
|---|---|
| PubChem CID | 103473685 |
| Molecular Formula | C10H12F4O3 |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanone |
| SMILES | O=C(COCC(F)(F)C(F)F)C1=COCCC1 |
| InChI | InChI=1S/C10H12F4O3/c11-9(12)10(13,14)6-17-5-8(15)7-2-1-3-16-4-7/h4,9H,1-3,5-6H2 |
| InChIKey | ZKTAUZGFIWSYEI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|