C10H14F4O2 — CID 103473788
5-methyl-1-(2,2,3,3-tetrafluoropropoxy)hex-5-en-2-one (PubChem CID 103473788) has the molecular formula C10H14F4O2 and a molecular weight of 242.21 g/mol. Its IUPAC name is 5-methyl-1-(2,2,3,3-tetrafluoropropoxy)hex-5-en-2-one.
| Compound Name | 5-methyl-1-(2,2,3,3-tetrafluoropropoxy)hex-5-en-2-one |
|---|---|
| PubChem CID | 103473788 |
| Molecular Formula | C10H14F4O2 |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 5-methyl-1-(2,2,3,3-tetrafluoropropoxy)hex-5-en-2-one |
| SMILES | C=C(C)CCC(=O)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H14F4O2/c1-7(2)3-4-8(15)5-16-6-10(13,14)9(11)12/h9H,1,3-6H2,2H3 |
| InChIKey | AENHXHQTMQKWMN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|