C11H14F4N2O4 — CID 103473932
1-(3,5-dimethoxypyrazin-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol (PubChem CID 103473932) has the molecular formula C11H14F4N2O4 and a molecular weight of 314.24 g/mol. Its IUPAC name is 1-(3,5-dimethoxypyrazin-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol.
| Compound Name | 1-(3,5-dimethoxypyrazin-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
|---|---|
| PubChem CID | 103473932 |
| Molecular Formula | C11H14F4N2O4 |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-(3,5-dimethoxypyrazin-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
| SMILES | COc1cnc(C(O)COCC(F)(F)C(F)F)c(OC)n1 |
| InChI | InChI=1S/C11H14F4N2O4/c1-19-7-3-16-8(9(17-7)20-2)6(18)4-21-5-11(14,15)10(12)13/h3,6,10,18H,4-5H2,1-2H3 |
| InChIKey | IEAITDWAINOEOR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|