C10H13F3N2O4 — CID 103217065
1-(3,5-dimethoxypyrazin-2-yl)-2-(2,2,2-trifluoroethoxy)ethanol (PubChem CID 103217065) has the molecular formula C10H13F3N2O4 and a molecular weight of 282.22 g/mol. Its IUPAC name is 1-(3,5-dimethoxypyrazin-2-yl)-2-(2,2,2-trifluoroethoxy)ethanol.
| Compound Name | 1-(3,5-dimethoxypyrazin-2-yl)-2-(2,2,2-trifluoroethoxy)ethanol |
|---|---|
| PubChem CID | 103217065 |
| Molecular Formula | C10H13F3N2O4 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 1-(3,5-dimethoxypyrazin-2-yl)-2-(2,2,2-trifluoroethoxy)ethanol |
| SMILES | COc1cnc(C(O)COCC(F)(F)F)c(OC)n1 |
| InChI | InChI=1S/C10H13F3N2O4/c1-17-7-3-14-8(9(15-7)18-2)6(16)4-19-5-10(11,12)13/h3,6,16H,4-5H2,1-2H3 |
| InChIKey | GBHXGERUZKINRM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |