C10H14F2N2O3 — CID 103147900
3-(2,2-difluoroethoxy)-1-(3-methoxypyrazin-2-yl)propan-1-ol (PubChem CID 103147900) has the molecular formula C10H14F2N2O3 and a molecular weight of 248.23 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(3-methoxypyrazin-2-yl)propan-1-ol.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(3-methoxypyrazin-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 103147900 |
| Molecular Formula | C10H14F2N2O3 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(3-methoxypyrazin-2-yl)propan-1-ol |
| SMILES | COc1nccnc1C(O)CCOCC(F)F |
| InChI | InChI=1S/C10H14F2N2O3/c1-16-10-9(13-3-4-14-10)7(15)2-5-17-6-8(11)12/h3-4,7-8,15H,2,5-6H2,1H3 |
| InChIKey | RGXAYFQGJMCUNZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|