C9H12F2N2O2 — CID 103147800
3-(2,2-difluoroethoxy)-1-pyrazin-2-ylpropan-1-ol (PubChem CID 103147800) has the molecular formula C9H12F2N2O2 and a molecular weight of 218.20 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-pyrazin-2-ylpropan-1-ol.
| Compound Name | 3-(2,2-difluoroethoxy)-1-pyrazin-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 103147800 |
| Molecular Formula | C9H12F2N2O2 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-pyrazin-2-ylpropan-1-ol |
| SMILES | OC(CCOCC(F)F)c1cnccn1 |
| InChI | InChI=1S/C9H12F2N2O2/c10-9(11)6-15-4-1-8(14)7-5-12-2-3-13-7/h2-3,5,8-9,14H,1,4,6H2 |
| InChIKey | JGRUOMKNICAQAV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|