C9H11FN2O3 — CID 135080474
ethyl (2R,3S)-2-fluoro-3-hydroxy-3-pyrazin-2-ylpropanoate (PubChem CID 135080474) has the molecular formula C9H11FN2O3 and a molecular weight of 214.20 g/mol. Its IUPAC name is ethyl (2R,3S)-2-fluoro-3-hydroxy-3-pyrazin-2-ylpropanoate.
| Compound Name | ethyl (2R,3S)-2-fluoro-3-hydroxy-3-pyrazin-2-ylpropanoate |
|---|---|
| PubChem CID | 135080474 |
| Molecular Formula | C9H11FN2O3 |
| Molecular Weight | 214.20 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | ethyl (2R,3S)-2-fluoro-3-hydroxy-3-pyrazin-2-ylpropanoate |
| SMILES | CCOC(=O)[C@H](F)[C@@H](O)c1cnccn1 |
| InChI | InChI=1S/C9H11FN2O3/c1-2-15-9(14)7(10)8(13)6-5-11-3-4-12-6/h3-5,7-8,13H,2H2,1H3/t7-,8+/m1/s1 |
| InChIKey | KWYOLYPLURDNRI-SFYZADRCSA-N |
| XLogP | 0.41 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |