About 7-chloro-1-decylindole
7-chloro-1-decylindole (PubChem CID 103474775) has the molecular formula C18H26ClN
and a molecular weight of 291.87 g/mol. Its IUPAC name is 7-chloro-1-decylindole.
Molecular Properties
| Compound Name | 7-chloro-1-decylindole |
| PubChem CID | 103474775 |
| Molecular Formula | C18H26ClN |
| Molecular Weight | 291.87 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 7-chloro-1-decylindole |
| SMILES | CCCCCCCCCCn1ccc2cccc(Cl)c21 |
| InChI | InChI=1S/C18H26ClN/c1-2-3-4-5-6-7-8-9-14-20-15-13-16-11-10-12-17(19)18(16)20/h10-13,15H,2-9,14H2,1H3 |
| InChIKey | UTWZPOPJCHWRJM-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.87 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-1-decylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1-decylindole?
The IUPAC name of 7-chloro-1-decylindole (CID 103474775) is 7-chloro-1-decylindole.
What is the SMILES notation for 7-chloro-1-decylindole?
The canonical SMILES for 7-chloro-1-decylindole is CCCCCCCCCCn1ccc2cccc(Cl)c21.
What is the InChIKey of 7-chloro-1-decylindole?
The InChIKey is UTWZPOPJCHWRJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26ClN/c1-2-3-4-5-6-7-8-9-14-20-15-13-16-11-10-12-17(19)18(16)20/h10-13,15H,2-9,14H2,1H3.
What are the key properties of 7-chloro-1-decylindole?
7-chloro-1-decylindole has a molecular weight of 291.87 g/mol, XLogP of 6.44, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1-decylindole is sourced from PubChem (CID 103474775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).