C14H19ClN2 — CID 103475461
2-(7-chloroindol-1-yl)-N,N-diethylethanamine (PubChem CID 103475461) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is 2-(7-chloroindol-1-yl)-N,N-diethylethanamine.
| Compound Name | 2-(7-chloroindol-1-yl)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 103475461 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-(7-chloroindol-1-yl)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCn1ccc2cccc(Cl)c21 |
| InChI | InChI=1S/C14H19ClN2/c1-3-16(4-2)10-11-17-9-8-12-6-5-7-13(15)14(12)17/h5-9H,3-4,10-11H2,1-2H3 |
| InChIKey | NQMGKBRZUXOOFT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |