C10H19F4NO2 — CID 103475122
5-methoxy-3-methyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-amine (PubChem CID 103475122) has the molecular formula C10H19F4NO2 and a molecular weight of 261.26 g/mol. Its IUPAC name is 5-methoxy-3-methyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-amine.
| Compound Name | 5-methoxy-3-methyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-amine |
|---|---|
| PubChem CID | 103475122 |
| Molecular Formula | C10H19F4NO2 |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 5-methoxy-3-methyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-amine |
| SMILES | COCCC(C)C(N)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H19F4NO2/c1-7(3-4-16-2)8(15)5-17-6-10(13,14)9(11)12/h7-9H,3-6,15H2,1-2H3 |
| InChIKey | MHKDHTYONVPPFH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|