C13H21F4NO — CID 103475953
N-propyl-1-(2,2,3,3-tetrafluoropropoxy)hept-6-yn-2-amine (PubChem CID 103475953) has the molecular formula C13H21F4NO and a molecular weight of 283.31 g/mol. Its IUPAC name is N-propyl-1-(2,2,3,3-tetrafluoropropoxy)hept-6-yn-2-amine.
| Compound Name | N-propyl-1-(2,2,3,3-tetrafluoropropoxy)hept-6-yn-2-amine |
|---|---|
| PubChem CID | 103475953 |
| Molecular Formula | C13H21F4NO |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-propyl-1-(2,2,3,3-tetrafluoropropoxy)hept-6-yn-2-amine |
| SMILES | C#CCCCC(COCC(F)(F)C(F)F)NCCC |
| InChI | InChI=1S/C13H21F4NO/c1-3-5-6-7-11(18-8-4-2)9-19-10-13(16,17)12(14)15/h1,11-12,18H,4-10H2,2H3 |
| InChIKey | YTBHCKAHZKTFFM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|