C6H5BrF4N2OS — CID 103476978
5-bromo-3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-thiadiazole (PubChem CID 103476978) has the molecular formula C6H5BrF4N2OS and a molecular weight of 309.08 g/mol. Its IUPAC name is 5-bromo-3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-thiadiazole.
| Compound Name | 5-bromo-3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 103476978 |
| Molecular Formula | C6H5BrF4N2OS |
| Molecular Weight | 309.08 g/mol |
| Exact Mass | 307.92 |
| IUPAC Name | 5-bromo-3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-thiadiazole |
| SMILES | FC(F)C(F)(F)COCc1nsc(Br)n1 |
| InChI | InChI=1S/C6H5BrF4N2OS/c7-5-12-3(13-15-5)1-14-2-6(10,11)4(8)9/h4H,1-2H2 |
| InChIKey | LUZUBCKCNZRKJY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.08 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|