C6H7F4N3OS — CID 103473440
3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 103473440) has the molecular formula C6H7F4N3OS and a molecular weight of 245.20 g/mol. Its IUPAC name is 3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 103473440 |
| Molecular Formula | C6H7F4N3OS |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | Nc1nc(COCC(F)(F)C(F)F)ns1 |
| InChI | InChI=1S/C6H7F4N3OS/c7-4(8)6(9,10)2-14-1-3-12-5(11)15-13-3/h4H,1-2H2,(H2,11,12,13) |
| InChIKey | AMTSOGHASFTUFH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|