C9H7F4N3O2 — CID 103477018
6-oxo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-5-carbonitrile (PubChem CID 103477018) has the molecular formula C9H7F4N3O2 and a molecular weight of 265.17 g/mol. Its IUPAC name is 6-oxo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-5-carbonitrile.
| Compound Name | 6-oxo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 103477018 |
| Molecular Formula | C9H7F4N3O2 |
| Molecular Weight | 265.17 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 6-oxo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(COCC(F)(F)C(F)F)[nH]c1=O |
| InChI | InChI=1S/C9H7F4N3O2/c10-8(11)9(12,13)4-18-3-6-15-2-5(1-14)7(17)16-6/h2,8H,3-4H2,(H,15,16,17) |
| InChIKey | SOGPRQCMOYEVGI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.17 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|