C9H9F2N3O2 — CID 103151250
2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 103151250) has the molecular formula C9H9F2N3O2 and a molecular weight of 229.19 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 103151250 |
| Molecular Formula | C9H9F2N3O2 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(CCOCC(F)F)[nH]c1=O |
| InChI | InChI=1S/C9H9F2N3O2/c10-7(11)5-16-2-1-8-13-4-6(3-12)9(15)14-8/h4,7H,1-2,5H2,(H,13,14,15) |
| InChIKey | AOWNPTWUDDGPPN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|