C9H12F3N3O2 — CID 103151252
5-(aminomethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 103151252) has the molecular formula C9H12F3N3O2 and a molecular weight of 251.21 g/mol. Its IUPAC name is 5-(aminomethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 5-(aminomethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103151252 |
| Molecular Formula | C9H12F3N3O2 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 5-(aminomethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | NCc1cnc(CCOCC(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C9H12F3N3O2/c10-9(11,12)5-17-2-1-7-14-4-6(3-13)8(16)15-7/h4H,1-3,5,13H2,(H,14,15,16) |
| InChIKey | VHMCCOZPALHKGS-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|