C9H11F3N2O3 — CID 114204897
5-(hydroxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 114204897) has the molecular formula C9H11F3N2O3 and a molecular weight of 252.19 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 5-(hydroxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114204897 |
| Molecular Formula | C9H11F3N2O3 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 5-(hydroxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(CCOCC(F)(F)F)ncc1CO |
| InChI | InChI=1S/C9H11F3N2O3/c10-9(11,12)5-17-2-1-7-13-3-6(4-15)8(16)14-7/h3,15H,1-2,4-5H2,(H,13,14,16) |
| InChIKey | TWSMPFWKZCPFOS-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|