C9H10F4N2O3 — CID 114204906
5-(hydroxymethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one (PubChem CID 114204906) has the molecular formula C9H10F4N2O3 and a molecular weight of 270.18 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-(hydroxymethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114204906 |
| Molecular Formula | C9H10F4N2O3 |
| Molecular Weight | 270.18 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 5-(hydroxymethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(COCC(F)(F)C(F)F)ncc1CO |
| InChI | InChI=1S/C9H10F4N2O3/c10-8(11)9(12,13)4-18-3-6-14-1-5(2-16)7(17)15-6/h1,8,16H,2-4H2,(H,14,15,17) |
| InChIKey | CIORMFRTMGCGQX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.18 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|