C9H13F2N3O2 — CID 103151251
5-(aminomethyl)-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 103151251) has the molecular formula C9H13F2N3O2 and a molecular weight of 233.22 g/mol. Its IUPAC name is 5-(aminomethyl)-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 5-(aminomethyl)-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103151251 |
| Molecular Formula | C9H13F2N3O2 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 5-(aminomethyl)-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | NCc1cnc(CCOCC(F)F)[nH]c1=O |
| InChI | InChI=1S/C9H13F2N3O2/c10-7(11)5-16-2-1-8-13-4-6(3-12)9(15)14-8/h4,7H,1-3,5,12H2,(H,13,14,15) |
| InChIKey | HWQGWAHDGYPEMH-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|