C9H10F2N2O4 — CID 103150196
2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidine-5-carboxylic acid (PubChem CID 103150196) has the molecular formula C9H10F2N2O4 and a molecular weight of 248.18 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 103150196 |
| Molecular Formula | C9H10F2N2O4 |
| Molecular Weight | 248.18 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(CCOCC(F)F)[nH]c1=O |
| InChI | InChI=1S/C9H10F2N2O4/c10-6(11)4-17-2-1-7-12-3-5(9(15)16)8(14)13-7/h3,6H,1-2,4H2,(H,15,16)(H,12,13,14) |
| InChIKey | DNGKUZJHQPVMGT-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|