C6H3F3N2O3 — CID 10750850
6-oxo-2-(trifluoromethyl)-1H-pyrimidine-5-carboxylic acid (PubChem CID 10750850) has the molecular formula C6H3F3N2O3 and a molecular weight of 208.09 g/mol. Its IUPAC name is 6-oxo-2-(trifluoromethyl)-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 6-oxo-2-(trifluoromethyl)-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 10750850 |
| Molecular Formula | C6H3F3N2O3 |
| Molecular Weight | 208.09 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 6-oxo-2-(trifluoromethyl)-1H-pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C6H3F3N2O3/c7-6(8,9)5-10-1-2(4(13)14)3(12)11-5/h1H,(H,13,14)(H,10,11,12) |
| InChIKey | CNLZIQCTGUBLFK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.09 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |