C11H17F2N3O2 — CID 114206255
2-[2-(2,2-difluoroethoxy)ethyl]-5-(ethylaminomethyl)-1H-pyrimidin-6-one (PubChem CID 114206255) has the molecular formula C11H17F2N3O2 and a molecular weight of 261.27 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-5-(ethylaminomethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-5-(ethylaminomethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114206255 |
| Molecular Formula | C11H17F2N3O2 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-5-(ethylaminomethyl)-1H-pyrimidin-6-one |
| SMILES | CCNCc1cnc(CCOCC(F)F)[nH]c1=O |
| InChI | InChI=1S/C11H17F2N3O2/c1-2-14-5-8-6-15-10(16-11(8)17)3-4-18-7-9(12)13/h6,9,14H,2-5,7H2,1H3,(H,15,16,17) |
| InChIKey | SEDVRJVWCGLWJJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|