C11H12F3N3O3 — CID 103477309
2-(2,2,2-trifluoroethoxymethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-4-carboxylic acid (PubChem CID 103477309) has the molecular formula C11H12F3N3O3 and a molecular weight of 291.23 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxymethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-4-carboxylic acid.
| Compound Name | 2-(2,2,2-trifluoroethoxymethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 103477309 |
| Molecular Formula | C11H12F3N3O3 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxymethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1nc(COCC(F)(F)F)nc2c1CCNC2 |
| InChI | InChI=1S/C11H12F3N3O3/c12-11(13,14)5-20-4-8-16-7-3-15-2-1-6(7)9(17-8)10(18)19/h15H,1-5H2,(H,18,19) |
| InChIKey | FJQSWSRLFPMYMT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |