C8H14F4N2O — CID 103477674
[3-methyl-1-(2,2,3,3-tetrafluoropropoxy)but-3-en-2-yl]hydrazine (PubChem CID 103477674) has the molecular formula C8H14F4N2O and a molecular weight of 230.20 g/mol. Its IUPAC name is [3-methyl-1-(2,2,3,3-tetrafluoropropoxy)but-3-en-2-yl]hydrazine.
| Compound Name | [3-methyl-1-(2,2,3,3-tetrafluoropropoxy)but-3-en-2-yl]hydrazine |
|---|---|
| PubChem CID | 103477674 |
| Molecular Formula | C8H14F4N2O |
| Molecular Weight | 230.20 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | [3-methyl-1-(2,2,3,3-tetrafluoropropoxy)but-3-en-2-yl]hydrazine |
| SMILES | C=C(C)C(COCC(F)(F)C(F)F)NN |
| InChI | InChI=1S/C8H14F4N2O/c1-5(2)6(14-13)3-15-4-8(11,12)7(9)10/h6-7,14H,1,3-4,13H2,2H3 |
| InChIKey | FLNRRDJHMUMOAK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|