C11H22F4N2O — CID 103477779
[4-methyl-1-(2,2,3,3-tetrafluoropropoxy)heptan-2-yl]hydrazine (PubChem CID 103477779) has the molecular formula C11H22F4N2O and a molecular weight of 274.30 g/mol. Its IUPAC name is [4-methyl-1-(2,2,3,3-tetrafluoropropoxy)heptan-2-yl]hydrazine.
| Compound Name | [4-methyl-1-(2,2,3,3-tetrafluoropropoxy)heptan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103477779 |
| Molecular Formula | C11H22F4N2O |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | [4-methyl-1-(2,2,3,3-tetrafluoropropoxy)heptan-2-yl]hydrazine |
| SMILES | CCCC(C)CC(COCC(F)(F)C(F)F)NN |
| InChI | InChI=1S/C11H22F4N2O/c1-3-4-8(2)5-9(17-16)6-18-7-11(14,15)10(12)13/h8-10,17H,3-7,16H2,1-2H3 |
| InChIKey | AAZOWHFESKFATQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|