C15H11BrClNO2 — CID 103479981
N-(2-bromo-3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-carboxamide (PubChem CID 103479981) has the molecular formula C15H11BrClNO2 and a molecular weight of 352.62 g/mol. Its IUPAC name is N-(2-bromo-3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-carboxamide.
| Compound Name | N-(2-bromo-3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 103479981 |
| Molecular Formula | C15H11BrClNO2 |
| Molecular Weight | 352.62 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | N-(2-bromo-3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Br)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C15H11BrClNO2/c16-14-11(17)2-1-3-12(14)18-15(19)10-4-5-13-9(8-10)6-7-20-13/h1-5,8H,6-7H2,(H,18,19) |
| InChIKey | UMPXYCUCTNMNEM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |