C16H14BrClN2O — CID 103479340
N-(2-bromo-3-chlorophenyl)-1,2,3,4-tetrahydroquinoline-6-carboxamide (PubChem CID 103479340) has the molecular formula C16H14BrClN2O and a molecular weight of 365.66 g/mol. Its IUPAC name is N-(2-bromo-3-chlorophenyl)-1,2,3,4-tetrahydroquinoline-6-carboxamide.
| Compound Name | N-(2-bromo-3-chlorophenyl)-1,2,3,4-tetrahydroquinoline-6-carboxamide |
|---|---|
| PubChem CID | 103479340 |
| Molecular Formula | C16H14BrClN2O |
| Molecular Weight | 365.66 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | N-(2-bromo-3-chlorophenyl)-1,2,3,4-tetrahydroquinoline-6-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Br)c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C16H14BrClN2O/c17-15-12(18)4-1-5-14(15)20-16(21)11-6-7-13-10(9-11)3-2-8-19-13/h1,4-7,9,19H,2-3,8H2,(H,20,21) |
| InChIKey | HKFTYDBFSQHLNY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |