C15H13ClN2O — CID 43325613
N-(2-chlorophenyl)-2,3-dihydro-1H-indole-5-carboxamide (PubChem CID 43325613) has the molecular formula C15H13ClN2O and a molecular weight of 272.74 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2,3-dihydro-1H-indole-5-carboxamide.
| Compound Name | N-(2-chlorophenyl)-2,3-dihydro-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 43325613 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | N-(2-chlorophenyl)-2,3-dihydro-1H-indole-5-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C15H13ClN2O/c16-12-3-1-2-4-14(12)18-15(19)11-5-6-13-10(9-11)7-8-17-13/h1-6,9,17H,7-8H2,(H,18,19) |
| InChIKey | GDFVLCLKEUHCKG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |