C16H15IN2O — CID 43325719
N-(2-iodophenyl)-1,2,3,4-tetrahydroquinoline-6-carboxamide (PubChem CID 43325719) has the molecular formula C16H15IN2O and a molecular weight of 378.21 g/mol. Its IUPAC name is N-(2-iodophenyl)-1,2,3,4-tetrahydroquinoline-6-carboxamide.
| Compound Name | N-(2-iodophenyl)-1,2,3,4-tetrahydroquinoline-6-carboxamide |
|---|---|
| PubChem CID | 43325719 |
| Molecular Formula | C16H15IN2O |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | N-(2-iodophenyl)-1,2,3,4-tetrahydroquinoline-6-carboxamide |
| SMILES | O=C(Nc1ccccc1I)c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C16H15IN2O/c17-13-5-1-2-6-15(13)19-16(20)12-7-8-14-11(10-12)4-3-9-18-14/h1-2,5-8,10,18H,3-4,9H2,(H,19,20) |
| InChIKey | FWOTZILTKRBSOM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|