C16H15BrN2O — CID 104938285
N-(3-bromo-2-methylphenyl)-2,3-dihydro-1H-indole-5-carboxamide (PubChem CID 104938285) has the molecular formula C16H15BrN2O and a molecular weight of 331.21 g/mol. Its IUPAC name is N-(3-bromo-2-methylphenyl)-2,3-dihydro-1H-indole-5-carboxamide.
| Compound Name | N-(3-bromo-2-methylphenyl)-2,3-dihydro-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 104938285 |
| Molecular Formula | C16H15BrN2O |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | N-(3-bromo-2-methylphenyl)-2,3-dihydro-1H-indole-5-carboxamide |
| SMILES | Cc1c(Br)cccc1NC(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C16H15BrN2O/c1-10-13(17)3-2-4-14(10)19-16(20)12-5-6-15-11(9-12)7-8-18-15/h2-6,9,18H,7-8H2,1H3,(H,19,20) |
| InChIKey | HJVNTZJEHLGPLV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |