C16H14Cl2N2O — CID 104727171
N-(2,5-dichloro-4-methylphenyl)-2,3-dihydro-1H-indole-5-carboxamide (PubChem CID 104727171) has the molecular formula C16H14Cl2N2O and a molecular weight of 321.21 g/mol. Its IUPAC name is N-(2,5-dichloro-4-methylphenyl)-2,3-dihydro-1H-indole-5-carboxamide.
| Compound Name | N-(2,5-dichloro-4-methylphenyl)-2,3-dihydro-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 104727171 |
| Molecular Formula | C16H14Cl2N2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | N-(2,5-dichloro-4-methylphenyl)-2,3-dihydro-1H-indole-5-carboxamide |
| SMILES | Cc1cc(Cl)c(NC(=O)c2ccc3c(c2)CCN3)cc1Cl |
| InChI | InChI=1S/C16H14Cl2N2O/c1-9-6-13(18)15(8-12(9)17)20-16(21)11-2-3-14-10(7-11)4-5-19-14/h2-3,6-8,19H,4-5H2,1H3,(H,20,21) |
| InChIKey | YXPMSMRJBSDKCO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |